Introduction：Basic information about CAS 405074-81-9|1-[Bis(trifluoromethanesulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[Bis(trifluoromethanesulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|
| CAS Number | 405074-81-9 | Molecular Weight | 446.21400 |
|---|
| Density | 1.896g/cm3 | Boiling Point | 381.965ºC at 760 mmHg |
|---|
| Molecular Formula | C9HF11O4S2 | Melting Point | 89ºC |
|---|
| MSDS | / | Flash Point | 184.806ºC |
|---|
Names
| Name | 1-[bis(trifluoromethylsulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.896g/cm3 |
|---|
| Boiling Point | 381.965ºC at 760 mmHg |
|---|
| Melting Point | 89ºC |
|---|
| Molecular Formula | C9HF11O4S2 |
|---|
| Molecular Weight | 446.21400 |
|---|
| Flash Point | 184.806ºC |
|---|
| Exact Mass | 445.91400 |
|---|
| PSA | 85.04000 |
|---|
| LogP | 5.41150 |
|---|
| Index of Refraction | 1.42 |
|---|
| InChIKey | RLLDXJXYMKTGPV-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(C(c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26;S36/S37/S39 |
|---|
| RIDADR | UN 3261 8/PG 3 |
|---|
Synonyms
| B2291 |
| α,α-Bis(trifluoromethanesulfonyl)-2,3,4,5,6-pentafluorotoluene |
| 2,3,4,5,6-Pentafluorophenylbis(trifluoromethanesulfonyl)methane |
| 1-[Bis(trifluoromethanesulfonyl)methyl]-2,3,4,5,6-pentafluorobenzene |
| MFCD04117910 |
