Introduction：Basic information about CAS 954-67-6|benzhydryl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzhydryl acetate |
|---|
| CAS Number | 954-67-6 | Molecular Weight | 226.27000 |
|---|
| Density | 1.097g/cm3 | Boiling Point | 316ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.6ºC |
|---|
Names
| Name | 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.097g/cm3 |
|---|
| Boiling Point | 316ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 127.6ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.33910 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | QBKMWJRMLACRJD-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OC(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Tresquim |
| Falcol |
| acetic acid diphenylmethyl ester |
| Aceclofenaco |
| Airtal |
| Aceclofenacum |
| acetic acid benzhydryl ester |
| Preservex |
| Gerbin |
| 1-acetoxy-1,1-diphenyl-methane |
| benzylic acetate |
| Aceclofar |
