Introduction:Basic information about CAS 35203-66-8|2,2,6,6-tetramethyl-4-((methylsulfonyl)oxy)-1-piperidinyloxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,6,6-tetramethyl-4-((methylsulfonyl)oxy)-1-piperidinyloxy |
|---|
| CAS Number | 35203-66-8 | Molecular Weight | 251.34300 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 380.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H21NO4S | Melting Point | 90-92ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 184ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-methanesulfonyl-2,2,6,6-tetramethyl-1-piperidinyloxy radical |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 380.6ºC at 760mmHg |
|---|
| Melting Point | 90-92ºC(lit.) |
|---|
| Molecular Formula | C10H21NO4S |
|---|
| Molecular Weight | 251.34300 |
|---|
| Flash Point | 184ºC |
|---|
| Exact Mass | 251.11900 |
|---|
| PSA | 75.22000 |
|---|
| LogP | 2.39210 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | KBVZXNJHHQKIOT-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC(OS(C)(=O)=O)CC(C)(C)N1O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2,2,6,6-tetramethyl-4-(methylsulfonyloxy)piperidine N-oxide |
| 2,2,6,6-TETRAMETHYL-4-(METHYLSULFONYLOXY)-1-PIPERIDINOOXY |
| 1-Piperidinyloxy,2,2,6,6-tetramethyl-4-[(methylsulfonyl)oxy] |
| 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy,free radical |
| 2,2,6,6-tetramethyl-4-((methylsulfonyl)oxy)-1-piperidinyloxy |
| 2,2,6,6-tetramethyl-4-(methylsulfonyloxy)-1-piper |
| 2,2,6,6-Tetramethylpiperidin-1-oxyl-4-sulfonat |
| 4-methanesulfonyloxy-TEMPO |
| MFCD00192489 |
| 2,2,6,6-tetramethyl-4-(methylsulfonyloxy)piperidinyl-1-oxide |