Introduction:Basic information about CAS 5408-10-6|2-Ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|
| CAS Number | 5408-10-6 | Molecular Weight | 211.21500 |
|---|
| Density | 1.262g/cm3 | Boiling Point | 397.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.3ºC |
|---|
Names
| Name | 5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.262g/cm3 |
|---|
| Boiling Point | 397.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO4 |
|---|
| Molecular Weight | 211.21500 |
|---|
| Flash Point | 194.3ºC |
|---|
| Exact Mass | 211.08400 |
|---|
| PSA | 79.39000 |
|---|
| LogP | 1.50640 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | VZZQCXPDRSMKPM-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)O)c1C |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,4-dimethyl-5-ethoxycarbonyl-3-pyrrolecarboxylic acid |
| 3,5-Dimethyl-pyrrol-2,4-dicarbonsaeure-2-aethylester |
| 2,4-Dimethyl-5-ethoxycarbonyl-3-carbonsaeure-pyrrol |
| 1H-Pyrrole-2,4-dicarboxylic acid,3,5-dimethyl-,2-ethyl ester |
| 3,5-dimethyl-pyrrole-2,4-dicarboxylic acid-2-ethyl ester |
| 5-(Ethoxycarbonyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| 2-Ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid 2-ethyl ester |
| 2,4-Dimethyl-3-carboxy-5-ethoxycarbonyl-pyrrol |
| 5-(ethoxycarbonyl)-2,4-dimethylpyrrole-3-carboxylic acid |