Introduction:Basic information about CAS 57777-84-1|1-(4-Nitrobenzenesulfonyl)-1H-1,2,4-triazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Nitrobenzenesulfonyl)-1H-1,2,4-triazole |
|---|
| CAS Number | 57777-84-1 | Molecular Weight | 254.22300 |
|---|
| Density | 1.49 g/mL(lit.) | Boiling Point | 506.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N4O4S | Melting Point | 140-142 °C(lit.) |
|---|
| MSDS | / | Flash Point | 260ºC |
|---|
Names
| Name | 1-(4-nitrophenyl)sulfonyl-1,2,4-triazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49 g/mL(lit.) |
|---|
| Boiling Point | 506.4ºC at 760mmHg |
|---|
| Melting Point | 140-142 °C(lit.) |
|---|
| Molecular Formula | C8H6N4O4S |
|---|
| Molecular Weight | 254.22300 |
|---|
| Flash Point | 260ºC |
|---|
| Exact Mass | 254.01100 |
|---|
| PSA | 119.05000 |
|---|
| LogP | 2.02730 |
|---|
| Index of Refraction | 1.726 |
|---|
| InChIKey | HMNOLKQVFZCVIW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)n2cncn2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(p-nitrobenzenesulfonyl)-1H-1,2,4-triazole |
| 1-(4-nitro-benzenesulfonyl)-1H-[1,2,4]triazole |
| 1-(p-Nitrobenzolsulfonyl)-(1H)-1,2,4-triazol |
| p-Nitrobenzolsulfonyltriazolid |
| EINECS 260-946-7 |
| 1-(4-Nitrophenylsulfonyl)-1,2,4-triazole |
| p-NBST |
| 1-[(4-nitrophenyl)sulfonyl]-1H-1,2,4-triazole |
| MFCD00079529 |