Introduction:Basic information about CAS 2050-16-0|Phenol,4,4'-(1,2-diazenediyl)bis-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4,4'-(1,2-diazenediyl)bis- |
|---|
| CAS Number | 2050-16-0 | Molecular Weight | 214.22000 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 392ºC at 760mmHg |
|---|
| Molecular Formula | C12H10N2O2 | Melting Point | 215 °C(dec.) |
|---|
| MSDS | / | Flash Point | 190.9ºC |
|---|
Names
| Name | 4-[(4-hydroxyphenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 392ºC at 760mmHg |
|---|
| Melting Point | 215 °C(dec.) |
|---|
| Molecular Formula | C12H10N2O2 |
|---|
| Molecular Weight | 214.22000 |
|---|
| Flash Point | 190.9ºC |
|---|
| Exact Mass | 214.07400 |
|---|
| PSA | 65.18000 |
|---|
| LogP | 3.51320 |
|---|
| Vapour Pressure | 1.04E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | WKODVHZBYIBMOC-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(N=Nc2ccc(O)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2927000090 |
|---|
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4'-Hydroxyazobenzene-4-ol |
| 4,4'-azobis(phenol) |
| 4,4-(diazene-1,2-diyl)diphenol |
| Phenol,4,4'-azobis |
| 4,4'-bis-hydroxyazobenzene |
| 4,4`-(1,2-Diazenediyl)bisphenol |
| 4-(4-hydroxy-phenylazo)phenol |
| 4,4'-Azodiphenol |
| Azobenzene-4,4'-diol |