Introduction：Basic information about CAS 599-86-0|Benzenesulfonamide,4-methyl-N-(4-methylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,4-methyl-N-(4-methylphenyl)- |
|---|
| CAS Number | 599-86-0 | Molecular Weight | 261.33900 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 403.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198ºC |
|---|
Names
| Name | 4-methyl-N-(4-methylphenyl)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 403.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO2S |
|---|
| Molecular Weight | 261.33900 |
|---|
| Flash Point | 198ºC |
|---|
| Exact Mass | 261.08200 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 4.25800 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | GPLXRIVINNIQFY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-Ts-p-toluidine |
| 4'-methyl-p-toluenesulfonanilide |
| Benzenesulfonamide,4-methyl-N-(4-methylphenyl) |
| N-(p-toluenesulfonyl)-2-methylaniline |
| 4-methyl-N-tosylbenzenamine |
| N-(4-methylphenyl)-p-toluenesulfonamide |
| 4-methyl-N-p-tolylbenzenesulfonamide |
| N-(p-Toluene sulfonyl)-p-toluidide |
