Introduction：Basic information about CAS 5939-57-1|2,3,16,20,25-Pentahydroxy-9-methyl-19-norlanosta-5,23-diene-11,22-dione (2beta,, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,16,20,25-Pentahydroxy-9-methyl-19-norlanosta-5,23-diene-11,22-dione (2beta,3alpha,9beta,10alpha,16alpha,23E)- |
|---|
| CAS Number | 5939-57-1 | Molecular Weight | 518.68200 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 669.5ºC at 760 mmHg |
|---|
| Molecular Formula | C30H46O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 372.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 669.5ºC at 760 mmHg |
|---|
| Molecular Formula | C30H46O7 |
|---|
| Molecular Weight | 518.68200 |
|---|
| Flash Point | 372.7ºC |
|---|
| Exact Mass | 518.32400 |
|---|
| PSA | 135.29000 |
|---|
| LogP | 2.72030 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | AOHIGMQGPFTKQX-QZPKXHNASA-N |
|---|
| SMILES | CC(C)(O)C=CC(=O)C(C)(O)C1C(O)CC2(C)C3CC=C4C(CC(O)C(O)C4(C)C)C3(C)C(=O)CC12C |
|---|
