Introduction：Basic information about CAS 1138444-10-6|2-Chloro-3-((trimethylsilyl)ethynyl)pyridin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-((trimethylsilyl)ethynyl)pyridin-4-amine |
|---|
| CAS Number | 1138444-10-6 | Molecular Weight | 224.76200 |
|---|
| Density | 1.13±0.1 g/cm3(Predicted) | Boiling Point | 328.0±42.0 °C(Predicted) |
|---|
| Molecular Formula | C10H13ClN2Si | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13±0.1 g/cm3(Predicted) |
|---|
| Boiling Point | 328.0±42.0 °C(Predicted) |
|---|
| Molecular Formula | C10H13ClN2Si |
|---|
| Molecular Weight | 224.76200 |
|---|
| Exact Mass | 224.05400 |
|---|
| PSA | 38.91000 |
|---|
| LogP | 3.12730 |
|---|
| InChIKey | XCPLDMMZZOBCFU-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)C#Cc1c(N)ccnc1Cl |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Hazard Codes | Xn |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2-chloro-3-[2-(trimethylsilyl)ethynyl]pyridin-4-amine |
| 2-Chloro-3-((trimethylsilyl)ethynyl)pyridin-4-amine |
| A-5989 |
