Introduction:Basic information about CAS 143157-22-6|2-Deoxy-2,2-difluoro-D-ribofuranose-3,5-dibenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Deoxy-2,2-difluoro-D-ribofuranose-3,5-dibenzoate |
|---|
| CAS Number | 143157-22-6 | Molecular Weight | 378.323 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 495.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H16F2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.7±28.7 °C |
|---|
Names
| Name | 2-Deoxy-2,2-difluoro-D-ribofuranose-3,5-dibenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 495.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H16F2O6 |
|---|
| Molecular Weight | 378.323 |
|---|
| Flash Point | 253.7±28.7 °C |
|---|
| Exact Mass | 378.091492 |
|---|
| PSA | 82.06000 |
|---|
| LogP | 4.69 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | PRZDMMRKPZAYHW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC1OC(O)C(F)(F)C1OC(=O)c1ccccc1)c1ccccc1 |
|---|
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
|---|
Synonyms
| 2-deoxy-2,2-difluoro-D-erythro-pentofuranos-1-ulose-3,5-dibenzoate |
| 2-deoxy-2,2-difluoro-D-ribofuranose-3,5-dibenzoate(T7) |
| 2-deoxy-2,2-difluoro-D-ribofuranose-3,5-dibenzoates |
| 3,5-di-O-benzoyl-2-deoxy-2,2-difluoro-D-arabinofuranose |
| 3,5-Di-O-benzoyl-2,2-difluoro-2-deoxyribose |
| 21-deoxy-21,21-difluoro-D-ribofuranose-3,5-dibenzoate |
| a-D-erythro-Pentofuranose,2-deoxy-2,2-difluoro-,3,5-dibenzoate |
| 2-Deoxy-2,2-difluoro-D-erythro-ribofuranose-3,5-dibenzoate |
| 1-bromo-2-deoxy-2,2-difluoro-D-ribofuranosyl-3,5-dibenzoate |
| D-erythro-Pentofuranose, 2-deoxy-2,2-difluoro-, 3,5-dibenzoate |
| 3,5-Di-O-benzoyl-2-deoxy-2,2-difluoro-D-ribofuranose |
| 3,5-Di-O-benzoyl-2-deoxy-2,2-difluoro-D-erythro-pentofuranose |
| ((2R,3R)-3-(benzoyloxy)-4,4-difluoro-5-hydroxytetrahydrofuran-2-yl)methyl benzoate |
| 2-deoxy-D-erythro-2,2-difluoro-ribofuranose-3,5-dibenzoate |