Introduction：Basic information about CAS 4079-64-5|H-D-Asp(oBzl)-oBzl.Tos, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-D-Asp(oBzl)-oBzl.Tos |
|---|
| CAS Number | 4079-64-5 | Molecular Weight | 485.549 |
|---|
| Density | / | Boiling Point | 455.3ºC at 760 mmHg |
|---|
| Molecular Formula | C25H27NO7S | Melting Point | 155-158 °C |
|---|
| MSDS | / | Flash Point | 180.5ºC |
|---|
Names
| Name | dibenzyl (2R)-2-aminobutanedioate,4-methylbenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 455.3ºC at 760 mmHg |
|---|
| Melting Point | 155-158 °C |
|---|
| Molecular Formula | C25H27NO7S |
|---|
| Molecular Weight | 485.549 |
|---|
| Flash Point | 180.5ºC |
|---|
| Exact Mass | 485.150818 |
|---|
| PSA | 141.37000 |
|---|
| LogP | 5.21340 |
|---|
| InChIKey | HLMUYZYLPUHSNV-PKLMIRHRSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| H-Asp(OBzl)-OBzl inverted exclamation mark currencyTosOH |
| (D)-H-Asp-(OBn)-OBn*p-TsOH |
| MFCD00035102 |
| (2R)-1,4-Bis(benzyloxy)-1,4-dioxo-2-butanaminium 4-methylbenzenesulfonate |
| (D)-Asp-(OBn)2*p-TsOH |
| h-d-asp(obzl)-obzl ptsa |
| D-Aspartic acid dibenzyl ester-p-toluenesulfonate |
| d-aspartic acid dibenzyl ester p-toluenesulfonate |
| d-aspartic acid dibenzyl ester tosylate |
| d-aspdb tsoh |
| h-d-asp(obzl)-obzl tos |
| D-aspartate dibenzylester p-toluenesulfonate |
| (R)-aspartic acid dibenzylester p-toluenesulfonate |
| D-Asp(OBn)-OBn*p-TsOH salt |
| D-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1) |
| Dibenzyl D-aspartate 4-methylbenzenesulfonate (1:1) |
| (R)-Dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate |
| dibenzyl L-aspartate*p-TsOH |
| H-D-Asp(OBzl)-OBzl.TosOH |
| D-aspartic acid dibenzyl ester toluene-p-sulfonate |
| H-D-Asp(oBzl)-oBzl.Tos |
