Introduction：Basic information about CAS 87494-13-1|Boc-S-trityl-D-cysteine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-S-trityl-D-cysteine |
|---|
| CAS Number | 87494-13-1 | Molecular Weight | 463.589 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 610.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C27H29NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 323.3±31.5 °C |
|---|
Names
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 610.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C27H29NO4S |
|---|
| Molecular Weight | 463.589 |
|---|
| Flash Point | 323.3±31.5 °C |
|---|
| Exact Mass | 463.181732 |
|---|
| PSA | 100.93000 |
|---|
| LogP | 7.52 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | JDTOWOURWBDELG-HSZRJFAPSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
|---|
| Storage condition | Store at 0°C |
|---|
Safety Information
Synonyms
| Boc-Cys(trt)-OH |
| boc-d-cys(trt)-oh |
| Boc-S-trityl-D-cysteine |
| N-[(1,1-dimethylethoxy)carbonyl]-S-trityl-L-cysteine |
| S-trityl-N-Boc-(R)-cysteine |
| Boc-Cys(Trt) |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-S-trityl-D-cysteine |
| D-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(triphenylmethyl)- |
| N-(tert-Butoxycarbonyl)-S-trityl-D-cysteine |
| AmbotzBAA5000 |
| N-t-butyloxycarbonyl-S-trityl-L-cysteine |
| S-trityl-N-Boc-cysteine |
| N-Boc-S-Trityl-L-Cysteine |
| N-t-butoxycarbonyl-S-trityl-L-Cysteine |
