Introduction:Basic information about CAS 15110-84-6|2,2'-[(3,3'-dichloro-4,4'-biphenylylene)bis(azo)]bis[2',5'-dimeth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[(3,3'-dichloro-4,4'-biphenylylene)bis(azo)]bis[2',5'-dimethoxyacetoacetanilide] |
|---|
| CAS Number | 15110-84-6 | Molecular Weight | 749.59700 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 850.2ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 468ºC |
|---|
Names
| Name | 2-[[2-chloro-4-[3-chloro-4-[[1-(2,5-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,5-dimethoxyphenyl)-3-oxobutanamide |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 850.2ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O8 |
|---|
| Molecular Weight | 749.59700 |
|---|
| Flash Point | 468ºC |
|---|
| Exact Mass | 748.18200 |
|---|
| PSA | 185.68000 |
|---|
| LogP | 9.35380 |
|---|
| Vapour Pressure | 3.38E-29mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | JCCCQHUBURSMDX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(OC)c(NC(=O)C(N=Nc2ccc(-c3ccc(N=NC(C(C)=O)C(=O)Nc4cc(OC)ccc4OC)c(Cl)c3)cc2Cl)C(C)=O)c1 |
|---|