Introduction:Basic information about CAS 2157-42-8|hexaethyl diorthosilicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hexaethyl diorthosilicate |
|---|
| CAS Number | 2157-42-8 | Molecular Weight | 342.53300 |
|---|
| Density | 0.999g/cm3 | Boiling Point | 273.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H30O7Si2 | Melting Point | 16ºC |
|---|
| MSDS | / | Flash Point | 105.1ºC |
|---|
Names
| Name | triethyl triethoxysilyl silicate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.999g/cm3 |
|---|
| Boiling Point | 273.9ºC at 760 mmHg |
|---|
| Melting Point | 16ºC |
|---|
| Molecular Formula | C12H30O7Si2 |
|---|
| Molecular Weight | 342.53300 |
|---|
| Flash Point | 105.1ºC |
|---|
| Exact Mass | 342.15300 |
|---|
| PSA | 64.61000 |
|---|
| LogP | 2.09320 |
|---|
| Vapour Pressure | 0.00935mmHg at 25°C |
|---|
| Index of Refraction | 1.423 |
|---|
| InChIKey | GYTROFMCUJZKNA-UHFFFAOYSA-N |
|---|
| SMILES | CCO[Si](OCC)(OCC)O[Si](OCC)(OCC)OCC |
|---|
Safety Information
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| disilicic acid hexaethyl ester |
| Hexaaethoxy-disiloxan |
| Hexaethoxydisiloxane |
| Hexaethyl diorthosilicate |
| Silicic acid,hexaethyl ester |
| Hexaaethyl-disilicat |
| Bis-triaethoxysilyl-aether |
| Dikieselsaeure-hexaaethylester |
| Silicic acid (H6Si2O7),hexaethyl ester |
| EINECS 218-469-7 |