Introduction：Basic information about CAS 57835-35-5|2-Bromo-4-(2,4,4-trimethylpent-2-yl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-4-(2,4,4-trimethylpent-2-yl)phenol |
|---|
| CAS Number | 57835-35-5 | Molecular Weight | 285.22000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H21BrO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-bromo-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H21BrO |
|---|
| Molecular Weight | 285.22000 |
|---|
| Exact Mass | 284.07800 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.86850 |
|---|
| InChIKey | CZNHJPFJMLYYCU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(Br)c1 |
|---|
Safety Information
Customs
| HS Code | 2908199090 |
|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|---|
Synonyms
| 2-Bromo-4-(2,4,4-trimethylpent-2-yl)phenol |
| 2-Brom-4-(1,1,3,3-tetramethyl-butyl)-phenol |
| 3-Brom-4-hydroxy-1-(1.1.3.3-tetramethyl-butyl)-benzol |
| 2-bromo-4-(1,1,3,3-tetramethylbutyl)phenol |
| 2-Bromo-4-t-octylphenol |
| 2-Bromo-4-(tert-octyl)phenol |
