Introduction:Basic information about CAS 123971-42-6|2-Thiazolecarboxylic acid,4-(4-methoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Thiazolecarboxylic acid,4-(4-methoxyphenyl)- |
|---|
| CAS Number | 123971-42-6 | Molecular Weight | 235.25900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H9NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(4-Methoxyphenyl)-1,3-thiazole-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H9NO3S |
|---|
| Molecular Weight | 235.25900 |
|---|
| Exact Mass | 235.03000 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 2.51690 |
|---|
| InChIKey | ZYQVZIBTYDJJHV-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2csc(C(=O)O)n2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|