Introduction：Basic information about CAS 26884-57-1|1,2,3,4-Tetrabromo-5,6-dimethoxybenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2,3,4-Tetrabromo-5,6-dimethoxybenzene |
|---|
| CAS Number | 26884-57-1 | Molecular Weight | 453.74800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H6Br4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,2,3,4-Tetrabromo-5,6-dimethoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H6Br4O2 |
|---|
| Molecular Weight | 453.74800 |
|---|
| Exact Mass | 449.71000 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.75380 |
|---|
| InChIKey | WCLKSQYCWXZMGX-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(Br)c(Br)c(Br)c(Br)c1OC |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1,2,3,4-tetrabromo-5,6-dimethoxy-benzene |
| Benzene,1,2,3,4-tetrabromo-5,6-dimethoxy |
| 1,2,3,4-Tetrabrom-5,6-dimethoxy-benzol |
| Tetrabrombrenzcatechin-dimethylaether |
| tetrabromoveratrole |
| Tetrabromveratrol |
| 3,4,5,6-Tetrabromo-1,2-dimethoxybenzene |
| Tetrabrom-1,2-dimethoxy-benzol |
| Tetrabromo-1,2-dimethoxybenzene |
