Introduction:Basic information about CAS 951021-12-8|bis(trifluoromethylsulfonyl)azanide,1,3-dihydroxyimidazol-1-ium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(trifluoromethylsulfonyl)azanide,1,3-dihydroxyimidazol-1-ium |
|---|
| CAS Number | 951021-12-8 | Molecular Weight | 381.23000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C5H5F6N3O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | bis(trifluoromethylsulfonyl)azanide,1,3-dihydroxyimidazol-1-ium |
|---|
Chemical & Physical Properties
| Molecular Formula | C5H5F6N3O6S2 |
|---|
| Molecular Weight | 381.23000 |
|---|
| Exact Mass | 380.95200 |
|---|
| PSA | 134.31000 |
|---|
| LogP | 2.47110 |
|---|
| Index of Refraction | n20/D 1.4275 |
|---|
| InChIKey | SWVAEQIBLYMHDX-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.On1cc[n+](O)c1 |
|---|