Introduction：Basic information about CAS 854646-60-9|Ethyl 2-methyl-3,5-dinitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2-methyl-3,5-dinitrobenzoate |
|---|
| CAS Number | 854646-60-9 | Molecular Weight | 254.19600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H10N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethyl 2-methyl-3,5-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H10N2O6 |
|---|
| Molecular Weight | 254.19600 |
|---|
| Exact Mass | 254.05400 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 3.03450 |
|---|
| InChIKey | DJFQGBZJRMAHMS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Dimethoxy-2-methyl-phenol |
| 6-Hydroxy-2.4-dimethoxy-toluol |
| 2-Oxy-4.6-dimethoxy-1-methyl-benzol |
| 2-hydroxy-4,6-dimethoxytoluene |
| 2-methyl-3,5-dimethoxyphenol |
| 2-Methyl-3,5-dinitro-benzoesaeure-aethylester |
| 2-Hydroxy-4,6-dimethoxy-toluol |
| 2-methyl-3,5-dinitro-benzoic acid ethyl ester |
| Phenol,3,5-dimethoxy-2-methyl |
