Introduction:Basic information about CAS 959238-23-4|8-bromo-4-chloro-2-(trifluoromethyl)quinazoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-bromo-4-chloro-2-(trifluoromethyl)quinazoline |
|---|
| CAS Number | 959238-23-4 | Molecular Weight | 311.48600 |
|---|
| Density | 1.815g/cm3 | Boiling Point | 165.353ºC at 760 mmHg |
|---|
| Molecular Formula | C9H3BrClF3N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 53.804ºC |
|---|
Names
| Name | 8-bromo-4-chloro-2-(trifluoromethyl)quinazoline |
|---|
Chemical & Physical Properties
| Density | 1.815g/cm3 |
|---|
| Boiling Point | 165.353ºC at 760 mmHg |
|---|
| Molecular Formula | C9H3BrClF3N2 |
|---|
| Molecular Weight | 311.48600 |
|---|
| Flash Point | 53.804ºC |
|---|
| Exact Mass | 309.91200 |
|---|
| PSA | 25.78000 |
|---|
| LogP | 4.06450 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | QZXRHWPACDPMTB-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1nc(Cl)c2cccc(Br)c2n1 |
|---|