CAS 86303-22-2|big chap
Introduction:Basic information about CAS 86303-22-2|big chap, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | big chap | ||
|---|---|---|---|
| CAS Number | 86303-22-2 | Molecular Weight | 878.055 |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1191.3±65.0 °C at 760 mmHg |
| Molecular Formula | C42H75N3O16 | Melting Point | 136-145ºC |
| MSDS | / | Flash Point | 674.3±34.3 °C |
Names
| Name | N,N-Bis[3-D-gluconamidopropyl]cholamide |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1191.3±65.0 °C at 760 mmHg |
| Melting Point | 136-145ºC |
| Molecular Formula | C42H75N3O16 |
| Molecular Weight | 878.055 |
| Flash Point | 674.3±34.3 °C |
| Exact Mass | 877.514709 |
| PSA | 341.50000 |
| LogP | -5.16 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | ZWEVPYNPHSPIFU-AUGHYPCGSA-N |
| SMILES | CC(CCC(=O)N(CCCNC(=O)C(O)C(O)C(O)C(O)CO)CCCNC(=O)C(O)C(O)C(O)C(O)CO)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| Storage condition | 2-8°C |
| Stability | Moisture Sensitive - Hygroscopic |
Safety Information
| Hazard Codes | T |
|---|---|
| Risk Phrases | 61-20/21-36/37/38 |
| Safety Phrases | S53-S22-S36/37/39-S45 |
| WGK Germany | 1 |
Synonyms
| MFCD00082541 |
| (2R,3S,4R,5R,2'R,3'S,4'R,5'R)-N,N'-[({(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-Trihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl}imino)di-3,1-propanediyl]bis(2,3,4,5,6-pentahydroxyhexanamide) (non-preferred name) |
| 2,3,4,5,6-pentahydroxy-N-[3-[3-(2,3,4,5,6-pentahydroxyhexanoylamino)propyl-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]propyl]hexanamide |
| (2R,3S,4R,5R,2'R,3'S,4'R,5'R)-N,N'-[({(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-Trihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl}imino)di-3,1-propanediyl]bis(2,3,4,5,6-pentahydroxyhexanamide) |
