Introduction：Basic information about CAS 1928-81-0|9H-Purine,6-(1-piperidinyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Purine,6-(1-piperidinyl)- |
|---|
| CAS Number | 1928-81-0 | Molecular Weight | 203.24400 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 330.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H13N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.8ºC |
|---|
Names
| Name | 6-piperidin-1-yl-7H-purine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 330.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H13N5 |
|---|
| Molecular Weight | 203.24400 |
|---|
| Flash Point | 153.8ºC |
|---|
| Exact Mass | 203.11700 |
|---|
| PSA | 57.70000 |
|---|
| LogP | 1.40820 |
|---|
| Vapour Pressure | 1.27E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | OXCZAXJFRBPQRP-UHFFFAOYSA-N |
|---|
| SMILES | c1nc(N2CCCCC2)c2[nH]cnc2n1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-piperidylpurine |
| 6-(piperidin-1-yl) purine |
| 6-(piperidin-1-yl)-7H-purine |
| 6-(piperidin-1-yl)-9H-purine |
| 6-(1-Piperidinyl)-9H-purin |
| 6-piperidin-1-yl-7(9)H-purine |
| 6-PIPERIDINOPURINE |
| 6-piperidinyl-purine |
