Introduction:Basic information about CAS 1226896-38-3|(R,R)-2-Iodo-1,3-bis[1-(Mesitylcarbamoyl)ethoxy]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R,R)-2-Iodo-1,3-bis[1-(Mesitylcarbamoyl)ethoxy]benzene |
|---|
| CAS Number | 1226896-38-3 | Molecular Weight | 614.514 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 710.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H35IN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 383.5±32.9 °C |
|---|
Names
| Name | (2R)-2-[2-iodo-3-[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl]oxyphenoxy]-N-(2,4,6-trimethylphenyl)propanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 710.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H35IN2O4 |
|---|
| Molecular Weight | 614.514 |
|---|
| Flash Point | 383.5±32.9 °C |
|---|
| Exact Mass | 614.164124 |
|---|
| PSA | 83.64000 |
|---|
| LogP | 7.83 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | ZVOKSLMZXDIXPR-DHIUTWEWSA-N |
|---|
| SMILES | Cc1cc(C)c(NC(=O)C(C)Oc2cccc(OC(C)C(=O)Nc3c(C)cc(C)cc3C)c2I)c(C)c1 |
|---|
Synonyms
| (R,R)-2-Iodo-1,3-bis[1-(2,4,6-trimethylphenylcarbamoyl)ethoxy]benzene |
| Propanamide, 2,2'-[(2-iodo-1,3-phenylene)bis(oxy)]bis[N-(2,4,6-trimethylphenyl)-, (2R,2'R)- |
| I0807 |
| Propanamide, 2,2'-[(2-iodo-1,3-phenylene)bis(oxy)]bis[N-(2,4,6-trimethylphenyl)- |
| (R,R)-2-Iodo-1,3-bis[1-(mesitylcarbamoyl)ethoxy]benzene |
| 2,2'-[(2-Iodo-1,3-phenylene)bis(oxy)]bis(N-mesitylpropanamide) |
| (2R,2'R)-2,2'-([2-iodo-1,3-phenylene]bis(oxy))bis(N-mesitylpropanamide) |
| (2R,2'R)-2,2'-[(2-Iodo-1,3-phenylene)bis(oxy)]bis(N-mesitylpropanamide) |