Introduction：Basic information about CAS 146824-89-7|1-(3,4-Dimethoxyphenyl)-3-methoxy-4(1H)-pyridazinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3,4-Dimethoxyphenyl)-3-methoxy-4(1H)-pyridazinone |
|---|
| CAS Number | 146824-89-7 | Molecular Weight | 262.26100 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 399.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H14N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.5ºC |
|---|
Names
| Name | 1-(3,4-dimethoxyphenyl)-3-methoxypyridazin-4-one |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 399.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H14N2O4 |
|---|
| Molecular Weight | 262.26100 |
|---|
| Flash Point | 195.5ºC |
|---|
| Exact Mass | 262.09500 |
|---|
| PSA | 62.58000 |
|---|
| LogP | 1.25830 |
|---|
| Vapour Pressure | 1.34E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | VEBAFICDNOSQEK-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-n2ccc(=O)c(OC)n2)cc1OC |
|---|
