Introduction:Basic information about CAS 191348-16-0|Fmoc-Tyr(HPO3Bzl)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Tyr(HPO3Bzl)-OH |
|---|
| CAS Number | 191348-16-0 | Molecular Weight | 573.530 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 803.3±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H28NO8P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 439.6±37.1 °C |
|---|
Names
| Name | 2-[9H-fluoren-9-ylmethoxycarbonyl(phosphono)amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 803.3±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H28NO8P |
|---|
| Molecular Weight | 573.530 |
|---|
| Flash Point | 439.6±37.1 °C |
|---|
| Exact Mass | 573.155273 |
|---|
| PSA | 141.20000 |
|---|
| LogP | 4.92 |
|---|
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | WNFKGEXQEWKECX-LJAQVGFWSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(OP(=O)(O)OCc2ccccc2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | -20°C |
|---|
Safety Information
Synonyms
| Fmoc-O-Bn-phospho-L-tyrosine |
| O-[(Benzyloxy)(hydroxy)phosphoryl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tyrosine |
| L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-(phenylmethyl)-N-phosphono- |
| O-Benzyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-phosphono-L-tyrosine |
| L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-[hydroxy(phenylmethoxy)phosphinyl]- |
| N-Fmoc-O-benzyl-L-phosphotyrosine |
| MFCD00797871 |
| Fmoc-Tyr(PO(OBzl)OH)-OH |
| Fmoc-Tyr(HPO3Bzl)-OH |