Introduction：Basic information about CAS 67-07-2|Phosphocreatine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphocreatine |
|---|
| CAS Number | 67-07-2 | Molecular Weight | 211.113 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 449.1±47.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H10N3O5P | Melting Point | >300 °C(lit.) |
|---|
| MSDS | / | Flash Point | 225.4±29.3 °C |
|---|
Names
| Name | N-phosphocreatine |
|---|
| Synonym | More Synonyms |
|---|
Phosphocreatine BiologicalActivity
| Description | Phosphocreatine, primarily found in the skeletal muscles of vertebrates and one of organic compounds known as alpha amino acids and derivatives, is a substrate for the determination of creatine kinase and used to regenerate ATP during skeletal muscle contraction[1].. |
|---|
| Related Catalog | Research Areas >>Metabolic Disease |
|---|
| References | [1]. Feldman EB, et al. Creatine: a dietary supplement and ergogenic aid. Nutr Rev. 1999 Feb;57(2):45-50. |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 449.1±47.0 °C at 760 mmHg |
|---|
| Melting Point | >300 °C(lit.) |
|---|
| Molecular Formula | C4H10N3O5P |
|---|
| Molecular Weight | 211.113 |
|---|
| Flash Point | 225.4±29.3 °C |
|---|
| Exact Mass | 211.035812 |
|---|
| PSA | 143.76000 |
|---|
| LogP | -3.39 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | DRBBFCLWYRJSJZ-UHFFFAOYSA-N |
|---|
| SMILES | CN(CC(=O)O)C(N)=NP(=O)(O)O |
|---|
| Water Solubility | practically insoluble |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | MF8260000 |
|---|
| HS Code | 2942000000 |
|---|
Customs
Synonyms
| Glycine, N-[imino(phosphonoamino)methyl]-N-methyl- |
| phosphagen |
| Creatine phosphate |
| Phosphorylcreatine |
| creatine-phosphate |
| N-Phosphorylcreatine |
| N-Phosphorocreatine |
| N-Phosphono-kreatin |
| N-methyl-N-phosphonocarbamimidoyl-glycine |
| EINECS 200-643-9 |
| Creatinephosphoric Acid |
| Neoton |
| Glycine, N-(imino(phosphonoamino)methyl)-N-methyl- |
| PhosphoCreatineSodiumC4H8N3Na2O5P |
| Phosphocreatine |
| N-Methyl-N-phosphonocarbamimidoyl-glycin |
| PC |
| Creatine phosphoric acid |
| Acide (N-méthyl-N'-phosphonocarbamimidamido)acétique |
| (N-Methyl-N'-phosphonocarbamimidamido)acetic acid |
| MFCD00152044 |
| N-Methyl-N-(N-phosphonocarbamimidoyl)glycine |
| N-phosphocreatine |
