Introduction:Basic information about CAS 67268-43-3|4-methyl-7-prop-2-ynoxychromen-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methyl-7-prop-2-ynoxychromen-2-one |
|---|
| CAS Number | 67268-43-3 | Molecular Weight | 214.21700 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.8ºC |
|---|
Names
| Name | 4-methyl-7-prop-2-ynoxychromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10O3 |
|---|
| Molecular Weight | 214.21700 |
|---|
| Flash Point | 162.8ºC |
|---|
| Exact Mass | 214.06300 |
|---|
| PSA | 39.44000 |
|---|
| LogP | 2.11340 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | NTNZDKLXIBVSQQ-UHFFFAOYSA-N |
|---|
| SMILES | C#CCOc1ccc2c(C)cc(=O)oc2c1 |
|---|
Synonyms
| 4-methyl-7-propargyloxycumarin |
| Giparmen |
| Giparmene |
| 7-propargyloxy-4-methyl-2H-chromen-2-one |