Introduction：Basic information about CAS 80638-08-0|N-Cyclohexyl-N-methyl-2-nitrobenzenemethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Cyclohexyl-N-methyl-2-nitrobenzenemethanamine |
|---|
| CAS Number | 80638-08-0 | Molecular Weight | 248.32100 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 350ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.5ºC |
|---|
Names
| Name | N-methyl-N-[(2-nitrophenyl)methyl]cyclohexanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 350ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20N2O2 |
|---|
| Molecular Weight | 248.32100 |
|---|
| Flash Point | 165.5ºC |
|---|
| Exact Mass | 248.15200 |
|---|
| PSA | 49.06000 |
|---|
| LogP | 3.88250 |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | GDRZPWMSPDDHEA-UHFFFAOYSA-N |
|---|
| SMILES | CN(Cc1ccccc1[N+](=O)[O-])C1CCCCC1 |
|---|
Synonyms
| EINECS 279-522-8 |
| N-Methyl-N-<2-nitro-benzyl>-cyclohexylamin |
| N-cyclohexyl-N-methyl-o-nitrobenzylamine |
| N-Cyclohexyl-N-methyl-2-nitrobenzenemethanamine |
| N-(2-Nitrobenzyl)-N-methylcyclohexanamine |
