Introduction：Basic information about CAS 83285-27-2|2,3-dichloro-3-(phenylsulphonyl)acrylonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-dichloro-3-(phenylsulphonyl)acrylonitrile |
|---|
| CAS Number | 83285-27-2 | Molecular Weight | 262.11300 |
|---|
| Density | 1.509g/cm3 | Boiling Point | 383.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5Cl2NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.6ºC |
|---|
Names
| Name | 3-(benzenesulfonyl)-2,3-dichloroprop-2-enenitrile |
|---|
Chemical & Physical Properties
| Density | 1.509g/cm3 |
|---|
| Boiling Point | 383.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5Cl2NO2S |
|---|
| Molecular Weight | 262.11300 |
|---|
| Flash Point | 185.6ºC |
|---|
| Exact Mass | 260.94200 |
|---|
| PSA | 66.31000 |
|---|
| LogP | 3.71138 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | PHKFZNHKWSVWNM-HJWRWDBZSA-N |
|---|
| SMILES | N#CC(Cl)=C(Cl)S(=O)(=O)c1ccccc1 |
|---|
