Introduction：Basic information about CAS 865304-71-8|TCMDC-132471, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | TCMDC-132471 |
|---|
| CAS Number | 865304-71-8 | Molecular Weight | 274.318 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 455.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.2±31.5 °C |
|---|
Names
| Name | 5-(4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 455.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N4O2 |
|---|
| Molecular Weight | 274.318 |
|---|
| Flash Point | 229.2±31.5 °C |
|---|
| Exact Mass | 274.142975 |
|---|
| PSA | 97.74000 |
|---|
| LogP | 2.18 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | HIKYTWIVLKHYIM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Oc2cnc(N)nc2N)c(C(C)C)c1 |
|---|
Synonyms
| 2,4-Pyrimidinediamine, 5-[4-methoxy-2-(1-methylethyl)phenoxy]- |
| 5-(2-Isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine |
| TCMDC-132471 |
| 5-(4-methoxy-2-propan-2-yl-phenoxy)pyrimidine-2,4-diamine |
| 5-(2-Isopropyl-4-methoxyphenoxy)pyrimidine-2,4-diamine |
