Introduction：Basic information about CAS 99983-92-3|2-benzylsulfanyl-6-chloropyrimidin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-benzylsulfanyl-6-chloropyrimidin-4-amine |
|---|
| CAS Number | 99983-92-3 | Molecular Weight | 251.73500 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 442.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClN3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.5ºC |
|---|
Names
| Name | 2-benzylsulfanyl-6-chloropyrimidin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 442.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClN3S |
|---|
| Molecular Weight | 251.73500 |
|---|
| Flash Point | 221.5ºC |
|---|
| Exact Mass | 251.02800 |
|---|
| PSA | 77.83000 |
|---|
| LogP | 2.93460 |
|---|
| Index of Refraction | 1.676 |
|---|
| InChIKey | LGTXUPUULSWTNA-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)nc(SCc2ccccc2)n1 |
|---|
Synonyms
| U-31,355 |
| 2-benzylmercapto-4-amino-6-chloropyrimidine |
| 2-benzylmercapto-6-chloro-pyrimidin-4-ylamine |
| 2-Benzylmercapto-6-chlor-pyrimidin-4-ylamin |
