Introduction：Basic information about CAS 40751-88-0|2-methoxy-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methoxy-3-nitrobenzoic acid |
|---|
| CAS Number | 40751-88-0 | Molecular Weight | 197.14500 |
|---|
| Density | 1.431 g/cm3 | Boiling Point | 373.293ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | 194 °C |
|---|
| MSDS | / | Flash Point | 179.561ºC |
|---|
Names
| Name | 2-methoxy-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.431 g/cm3 |
|---|
| Boiling Point | 373.293ºC at 760 mmHg |
|---|
| Melting Point | 194 °C |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.14500 |
|---|
| Flash Point | 179.561ºC |
|---|
| Exact Mass | 197.03200 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 1.82480 |
|---|
| InChIKey | GMSYODOBBOEWCM-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(C(=O)O)cccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| X8088 |
| 3-nitro-2-methoxybenzoic acid |
| 2-methoxy-3-nitro-benzoic acid |
| Methylaether-3-nitro-salicylsaeure |
| 2-Methoxy-3-nitro-benzoesaeure |
| Benzoic acid,2-methoxy-3-nitro |
