Introduction:Basic information about CAS 5193-92-0|6-[(2-chloro-6-nitrophenyl)methylamino]-1H-pyrimidine-2,4-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-[(2-chloro-6-nitrophenyl)methylamino]-1H-pyrimidine-2,4-dione |
|---|
| CAS Number | 5193-92-0 | Molecular Weight | 296.66700 |
|---|
| Density | 1.59g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H9ClN4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-[(2-chloro-6-nitrophenyl)methylamino]-1H-pyrimidine-2,4-dione |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Molecular Formula | C11H9ClN4O4 |
|---|
| Molecular Weight | 296.66700 |
|---|
| Exact Mass | 296.03100 |
|---|
| PSA | 124.09000 |
|---|
| LogP | 2.65770 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | TZDQNVYJEWYSSX-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cc(NCc2c(Cl)cccc2[N+](=O)[O-])[nH]c(=O)[nH]1 |
|---|