Introduction：Basic information about CAS 54574-01-5|6'-(diethylamino)-2'-(octylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6'-(diethylamino)-2'-(octylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|---|
| CAS Number | 54574-01-5 | Molecular Weight | 498.65600 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 677.1ºC at 760 mmHg |
|---|
| Molecular Formula | C32H38N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 363.3ºC |
|---|
Names
| Name | 6'-(diethylamino)-2'-(octylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 677.1ºC at 760 mmHg |
|---|
| Molecular Formula | C32H38N2O3 |
|---|
| Molecular Weight | 498.65600 |
|---|
| Flash Point | 363.3ºC |
|---|
| Exact Mass | 498.28800 |
|---|
| PSA | 50.80000 |
|---|
| LogP | 7.94620 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | NMDQDUHQWBIVNL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCNc1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(N(CC)CC)cc1O2 |
|---|
Synonyms
| EINECS 259-237-5 |
| 6'-(diethylamino)-2'-(octylamino)-3h-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| 6-(Diethylamino)-2-(octylamino)fluoran |
| 6'-(Diethylamino)-2'-(octylamino)spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one |
