Introduction：Basic information about CAS 54622-43-4|2-hydroxy-1,3-propylenediamine-N,N,N',N'-tetra(methylenephosphonic acid), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-hydroxy-1,3-propylenediamine-N,N,N',N'-tetra(methylenephosphonic acid) |
|---|
| CAS Number | 54622-43-4 | Molecular Weight | 466.15000 |
|---|
| Density | 1.999g/cm3 | Boiling Point | 917.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H22N2O13P4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 508.9ºC |
|---|
Names
| Name | [[3-[bis(phosphonomethyl)amino]-2-hydroxypropyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|
Chemical & Physical Properties
| Density | 1.999g/cm3 |
|---|
| Boiling Point | 917.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H22N2O13P4 |
|---|
| Molecular Weight | 466.15000 |
|---|
| Flash Point | 508.9ºC |
|---|
| Exact Mass | 466.00700 |
|---|
| PSA | 296.07000 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | GWGQWFHTAOMUBD-UHFFFAOYSA-N |
|---|
| SMILES | O=P(O)(O)CN(CC(O)CN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
|---|
