Introduction:Basic information about CAS 1284-72-6|bis(cyclopentadienyl)magnesium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(cyclopentadienyl)magnesium |
|---|
| CAS Number | 1284-72-6 | Molecular Weight | 154.49100 |
|---|
| Density | / | Boiling Point | 290°C |
|---|
| Molecular Formula | C10H10Mg | Melting Point | 180 °C (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 290°C |
|---|
| Symbol | GHS02, GHS05 | Signal Word | Danger |
|---|
Names
| Name | bis(cyclopentadienyl)magnesium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 290°C |
|---|
| Melting Point | 180 °C (dec.)(lit.) |
|---|
| Molecular Formula | C10H10Mg |
|---|
| Molecular Weight | 154.49100 |
|---|
| Flash Point | 290°C |
|---|
| Exact Mass | 154.06300 |
|---|
| LogP | 2.04300 |
|---|
| InChIKey | WGESBNRUPISICS-UHFFFAOYSA-N |
|---|
| SMILES | [Mg+2].c1cc[cH-]c1.c1cc[cH-]c1 |
|---|
Safety Information
| Symbol | GHS02, GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H228-H250-H261-H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P210-P231 + P232-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 + P310-P335 + P334-P422 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | F:Highlyflammable; |
|---|
| Risk Phrases | R17 |
|---|
| Safety Phrases | S26-S36/37/39-S43-S45-S8 |
|---|
| RIDADR | UN 3393 4.2/PG 1 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | I |
|---|
| Hazard Class | 4.2 |
|---|
Synonyms
| Magncsocenc |
| MAGNESOCENE,SUBLIMED |
| DICYCLOPENTADIENYL MAGNESIUM |
| Magnesocene |
| MFCD00134487 |