Introduction：Basic information about CAS 2134-91-0|4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid |
|---|
| CAS Number | 2134-91-0 | Molecular Weight | 212.15600 |
|---|
| Density | 1.549g/cm3 | Boiling Point | 455.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H8O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.2ºC |
|---|
Names
| Name | 4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.549g/cm3 |
|---|
| Boiling Point | 455.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H8O6 |
|---|
| Molecular Weight | 212.15600 |
|---|
| Flash Point | 188.2ºC |
|---|
| Exact Mass | 212.03200 |
|---|
| PSA | 104.06000 |
|---|
| LogP | 0.79720 |
|---|
| Vapour Pressure | 4.29E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | NLSSJYQPZIQJNC-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)cc(C(=O)O)c1O |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Hydroxy-5-methoxy-isophthalsaeure |
| 5-Carboxy-vanilinsaeure |
| 4-hydroxy-5-methoxy-isophthalic acid |
| 5-Carboxyvanillic acid |
| 5-Carboxy-vanillinsaeure |
| 5-carboxyvanillate |
| 4-Hydroxy-5-methoxyisophthalate |
| EINECS 218-366-7 |
