Introduction：Basic information about CAS 53008-65-4|Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside |
|---|
| CAS Number | 53008-65-4 | Molecular Weight | 464.550 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 593.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H32O6 | Melting Point | 67ºC |
|---|
| MSDS | / | Flash Point | 312.5±30.1 °C |
|---|
Names
| Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 593.0±50.0 °C at 760 mmHg |
|---|
| Melting Point | 67ºC |
|---|
| Molecular Formula | C28H32O6 |
|---|
| Molecular Weight | 464.550 |
|---|
| Flash Point | 312.5±30.1 °C |
|---|
| Exact Mass | 464.219879 |
|---|
| PSA | 66.38000 |
|---|
| LogP | 6.94 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | MOKYEUQDXDKNDX-DFLSAPQXSA-N |
|---|
| SMILES | COC1OC(CO)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
|---|
Synonyms
| α-D-Glucopyranoside, methyl 2,3,4-tris-O-(phenylmethyl)- |
| Methyl2,3,4-tri-O-benzyl-a-D-glucopyranoside |
| Methyl 2,3,4-Tri-O-benzyl-Alpha-D-glucopyranoside |
| Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside |
