Introduction：Basic information about CAS 19851-61-7|Dibenzyl benzene-1,4-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dibenzyl benzene-1,4-dicarboxylate |
|---|
| CAS Number | 19851-61-7 | Molecular Weight | 346.37600 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 500ºC at 760mmHg |
|---|
| Molecular Formula | C22H18O4 | Melting Point | 95-97ºC |
|---|
| MSDS | / | Flash Point | 252.6ºC |
|---|
Names
| Name | dibenzyl benzene-1,4-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 500ºC at 760mmHg |
|---|
| Melting Point | 95-97ºC |
|---|
| Molecular Formula | C22H18O4 |
|---|
| Molecular Weight | 346.37600 |
|---|
| Flash Point | 252.6ºC |
|---|
| Exact Mass | 346.12100 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.40060 |
|---|
| Vapour Pressure | 3.96E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | IWGFEQWCMAADJZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)c1ccc(C(=O)OCc2ccccc2)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Terephthalic acid,dibenzyl ester |
| p-dibenzyl benzenedicarboxylate |
| Terephthalsaeure-dibenzylester |
| Dibenzyl terephthalate |
| EINECS 243-370-0 |
