Introduction：Basic information about CAS 35453-19-1|5-Amino-2,4,6-triiodoisophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Amino-2,4,6-triiodoisophthalic acid |
|---|
| CAS Number | 35453-19-1 | Molecular Weight | 558.835 |
|---|
| Density | 3.1±0.1 g/cm3 | Boiling Point | 539.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4I3NO4 | Melting Point | 265-270 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 280.0±30.1 °C |
|---|
| Symbol |
GHS08 | Signal Word | Danger |
|---|
Names
| Name | 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 3.1±0.1 g/cm3 |
|---|
| Boiling Point | 539.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 265-270 °C(lit.) |
|---|
| Molecular Formula | C8H4I3NO4 |
|---|
| Molecular Weight | 558.835 |
|---|
| Flash Point | 280.0±30.1 °C |
|---|
| Exact Mass | 558.727417 |
|---|
| PSA | 100.62000 |
|---|
| LogP | 0.60 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.869 |
|---|
| InChIKey | JEZJSNULLBSYHV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(I)c(C(=O)O)c(I)c(C(=O)O)c1I |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Symbol |
GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H317-H334 |
|---|
| Precautionary Statements | P261-P280-P342 + P311 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R42/43 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-Amino-2,4,6-triiodoisophthalic acid |
| 5-Amino-2,4,6-trijod-isophthalsaeure |
| 5-amino-2,4,6-triiodophthalic acid |
| 5-amino-2,4,6-triiodo-1,3-benzenedicarboxylic acid |
| Isophthalic acid,5-amino-2,4,6-triiodo |
| 5-Amino-2,4,6-triiodoisophthalicacid |
| 5-amino-2,4,6-triiodophenyl-1,3-dicarboxylic acid |
| 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
| MFCD00190167 |
| 1,3-Benzenedicarboxylic acid, 5-amino-2,4,6-triiodo- |
| EINECS 252-575-4 |
