CAS 85068-33-3|[3,5-Bis(trifluoromethyl)phenyl]acetic acid
Introduction：Basic information about CAS 85068-33-3|[3,5-Bis(trifluoromethyl)phenyl]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [3,5-Bis(trifluoromethyl)phenyl]acetic acid | ||
|---|---|---|---|
| CAS Number | 85068-33-3 | Molecular Weight | 272.144 |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 227.7±35.0 °C at 760 mmHg |
| Molecular Formula | C10H6F6O2 | Melting Point | 121-123 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 91.5±25.9 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 3,5-Bis(trifluoromethyl)phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 227.7±35.0 °C at 760 mmHg |
| Melting Point | 121-123 °C(lit.) |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.144 |
| Flash Point | 91.5±25.9 °C |
| Exact Mass | 272.027191 |
| PSA | 37.30000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.428 |
| InChIKey | PAWSKKHEEYTXSA-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
Customs
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Articles2
More Articles| Municipal landfill leachates: a significant source for new and emerging pollutants. Sci. Total Environ. 408(21) , 5147-57, (2010) Landfills have historically remained the most common methods of organized waste disposal and still remain so in many regions of the world. Thus, they may contain wastes resulting from several decades ... | |
| Parallel synthesis of chiral pentaamines and pyrrolidine containing bis-heterocyclic libraries. Multiple scaffolds with multiple building blocks: a double diversity for the identification of new antitubercular compounds. Bioorg. Med. Chem. Lett. 19(17) , 5169-75, (2009) Combinatorial chemistry offers a unique opportunity for the synthesis and screening of large numbers of compounds and significantly enhances the prospect of finding new drugs. Collaborative efforts wi... |
Synonyms
| EINECS 285-295-6 |
| 3,5-Di(trifluoromethyl)phenylacetic acid |
| 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid |
| [3,5-Bis(trifluoromethyl)phenyl]acetic acid |
| 2-[3,5-Di(trifluoromethyl)phenyl]acetic acid |
| 3,5-Bis(trifluoromethyl)phenylacetic acid |
| Benzeneacetic acid, 3,5-bis(trifluoromethyl)- |
| FXFFR C1VQ EXFFF |
| MFCD00009908 |
