Introduction:Basic information about CAS 83066-88-0|Fluazifop-P, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fluazifop-P |
|---|
| CAS Number | 83066-88-0 | Molecular Weight | 327.25500 |
|---|
| Density | 1.37 g/cm3 | Boiling Point | 429.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12F3NO4 | Melting Point | 5ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 213.8ºC |
|---|
Names
| Name | (R)-fluazifop |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37 g/cm3 |
|---|
| Boiling Point | 429.9ºC at 760 mmHg |
|---|
| Melting Point | 5ºC |
|---|
| Molecular Formula | C15H12F3NO4 |
|---|
| Molecular Weight | 327.25500 |
|---|
| Flash Point | 213.8ºC |
|---|
| Exact Mass | 327.07200 |
|---|
| PSA | 68.65000 |
|---|
| LogP | 3.74460 |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | YUVKUEAFAVKILW-SECBINFHSA-N |
|---|
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)C(=O)O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933399021 |
|---|
Customs
| HS Code | 2933399021 |
|---|
| Summary | 2933399021 (r)-2-(4-((5-(trifluoromethyl)pyridin-2-yl)oxy)phenoxy)propanoic acid。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|---|
Synonyms
| (R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid |
| (2R)-2-{4-([5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
| (2R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| Fusilade DX |
| (2R)-2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid |
| Fluazifop-P |
| fluazifop-P |