Introduction:Basic information about CAS 2613-26-5|3-nitrophenylsulfur pentafluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-nitrophenylsulfur pentafluoride |
|---|
| CAS Number | 2613-26-5 | Molecular Weight | 249.15800 |
|---|
| Density | 1.665 g/mL at 25 °C(lit.) | Boiling Point | 106 °C2 mm Hg(lit.) |
|---|
| Molecular Formula | C6H4F5NO2S | Melting Point | 0℃ |
|---|
| MSDS | USA | Flash Point | >230 °F |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | pentafluoro-(3-nitrophenyl)-λ6-sulfane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.665 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 106 °C2 mm Hg(lit.) |
|---|
| Melting Point | 0℃ |
|---|
| Molecular Formula | C6H4F5NO2S |
|---|
| Molecular Weight | 249.15800 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 248.98800 |
|---|
| PSA | 71.12000 |
|---|
| LogP | 4.77540 |
|---|
| Index of Refraction | n20/D 1.475(lit.) |
|---|
| InChIKey | FSTNQYCPXJMFMT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(S(F)(F)(F)(F)F)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi,T,Xn |
|---|
| Risk Phrases | R23/24/25;R36/38 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 2810 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| meta-nitro(pentafluorosulfanyl)benzenes |
| m-nitro(pentafluorosulfanyl)benzene |
| MFCD00221621 |
| meta-nitro-(pentafluorosulfanyl)benzene |
| 3-(Pentafluorothio)nitrobenzene |
| m-(pentafluorosulfanyl)nitrobenzene |
| 3-nitrophenylsulphur pentafluoride |
| EINECS 447-600-2 |
| 3-Nitrophenylsulfur Pentafluoride |
| 1-nitro-3-(pentafluorosulfanyl)benzene |
| pentafluoro-(3-nitrophenyl) |