Introduction:Basic information about CAS 2673-23-6|[1,1'-Biphenyl]-4,4'-diacetaldehyde,a4,a4'-dioxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1'-Biphenyl]-4,4'-diacetaldehyde,a4,a4'-dioxo- |
|---|
| CAS Number | 2673-23-6 | Molecular Weight | 266.24800 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 431.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188ºC |
|---|
Names
| Name | 2-[4-(4-oxaldehydoylphenyl)phenyl]-2-oxoacetaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 431.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H10O4 |
|---|
| Molecular Weight | 266.24800 |
|---|
| Flash Point | 188ºC |
|---|
| Exact Mass | 266.05800 |
|---|
| PSA | 68.28000 |
|---|
| LogP | 2.11680 |
|---|
| Vapour Pressure | 1.16E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | ODRKIKHWTZCVCM-UHFFFAOYSA-N |
|---|
| SMILES | O=CC(=O)c1ccc(-c2ccc(C(=O)C=O)cc2)cc1 |
|---|
Synonyms
| 4,4'-Biphenylglyoxal |
| 4,4'-Bisglyoxalyldiphenyl |
| 4,4'-Diglyoxalylbiphenyl |
| Xenylgloxal |
| Xenygloxal |
| 4,4'-Di-glyoxyloyl-biphenyl |
| Xenygloxal [INN] |
| Xenadial |
| Xenygloxalum |
| 4,4'-Bis-glyoxyloyl-diphenyl |
| Xenaldial |
| 4,4'-di-oxoacetyl-biphenyl |
| 4,4'-Biphenyldiglyoxylaldehyde |