Introduction:Basic information about CAS 306936-40-3|2,5-dimethyl-4-(2-thienylaminosulphonyl)furan-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dimethyl-4-(2-thienylaminosulphonyl)furan-3-carboxylic acid |
|---|
| CAS Number | 306936-40-3 | Molecular Weight | 315.365 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 518.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H13NO5S2 | Melting Point | 167ºC |
|---|
| MSDS | / | Flash Point | 267.3±32.9 °C |
|---|
Names
| Name | 2,5-dimethyl-4-(thiophen-2-ylmethylsulfamoyl)furan-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 518.4±60.0 °C at 760 mmHg |
|---|
| Melting Point | 167ºC |
|---|
| Molecular Formula | C12H13NO5S2 |
|---|
| Molecular Weight | 315.365 |
|---|
| Flash Point | 267.3±32.9 °C |
|---|
| Exact Mass | 315.023499 |
|---|
| PSA | 133.23000 |
|---|
| LogP | 2.15 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | BXMCNOINQHTKEJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1oc(C)c(S(=O)(=O)NCc2cccs2)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 2,5-Dimethyl-4-[(2-thienylmethyl)sulfamoyl]-3-furoic acid |
| 2,5-dimethyl-4-{[(2-thienylmethyl)amino]sulfonyl}-3-furoic acid |
| 2,4-DIMETHYLBENZYL CHLORIDE |
| MFCD02180782 |
| 2,5-Dimethyl-4-{[(thien-2-ylmethyl)amino]sulphonyl}furan-3-carboxylic acid |
| 2,5-dimethyl-4-{[(thien-2-ylmethyl)amino]sulfonyl}-3-furoic acid |
| 3-Furancarboxylic acid, 2,5-dimethyl-4-[[(2-thienylmethyl)amino]sulfonyl]- |
| 2,5-dimethyl-4-[(thiophen-2-ylmethyl)sulfamoyl]furan-3-carboxylic acid |
| 2,5-Dimethyl-4-[[(2-thienylmethyl)amino]sulfonyl]-3-furoic acid |