Introduction：Basic information about CAS 151772-58-6|nonafluoro-3,6-dioxaheptanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | nonafluoro-3,6-dioxaheptanoic acid |
|---|
| CAS Number | 151772-58-6 | Molecular Weight | 296.04500 |
|---|
| Density | 1.765g/cm3 | Boiling Point | 145ºC |
|---|
| Molecular Formula | C5HF9O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 66.2ºC |
|---|
Names
| Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.765g/cm3 |
|---|
| Boiling Point | 145ºC |
|---|
| Molecular Formula | C5HF9O4 |
|---|
| Molecular Weight | 296.04500 |
|---|
| Flash Point | 66.2ºC |
|---|
| Exact Mass | 295.97300 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.40240 |
|---|
| InChIKey | PPWRLPJIHGWGFH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
|---|
Safety Information
| Hazard Codes | C,Xi |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| nonafluoro-3,6-dioxaheptanoic acid |
| Perfluoro-3,6-dioxaheptanoic acid |
| PC5519 |
| Acetic acid,2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy] |
