Introduction:Basic information about CAS 15181-11-0|3,5-Di-|tert|-butyltoluene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Di-|tert|-butyltoluene |
|---|
| CAS Number | 15181-11-0 | Molecular Weight | 204.35100 |
|---|
| Density | 0.86 | Boiling Point | 244ºC(lit.) |
|---|
| Molecular Formula | C15H24 | Melting Point | 31-32ºC(lit.) |
|---|
| MSDS | / | Flash Point | 196 °F |
|---|
Names
| Name | 3,5-Di-tert-butyltoluene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.86 |
|---|
| Boiling Point | 244ºC(lit.) |
|---|
| Melting Point | 31-32ºC(lit.) |
|---|
| Molecular Formula | C15H24 |
|---|
| Molecular Weight | 204.35100 |
|---|
| Flash Point | 196 °F |
|---|
| Exact Mass | 204.18800 |
|---|
| LogP | 4.59000 |
|---|
| Vapour Pressure | 0.0486mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.49(lit.) |
|---|
| InChIKey | WIXDSJRJFDWTNY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | 1325.0 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 4.1 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| EINECS 239-230-3 |
| 3,5-Di-tert-butyl-1-methylbenzene |
| 1,3-Di-tert-butyl-5-methylbenzene |
| MFCD00026300 |
| 1,3-ditert-butyl-5-methylbenzene |