Introduction：Basic information about CAS 807-28-3|1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane |
|---|
| CAS Number | 807-28-3 | Molecular Weight | 410.655 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.4±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H26OSi2 | Melting Point | 46-49ºC |
|---|
| MSDS | / | Flash Point | 181.0±21.6 °C |
|---|
Names
| Name | methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 441.4±18.0 °C at 760 mmHg |
|---|
| Melting Point | 46-49ºC |
|---|
| Molecular Formula | C26H26OSi2 |
|---|
| Molecular Weight | 410.655 |
|---|
| Flash Point | 181.0±21.6 °C |
|---|
| Exact Mass | 410.152222 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 9.96 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | RFGGTTPASBFBTB-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane |
| Disiloxane,1,3-dimethyl-1,1,3,3-tetraphenyl |
| Ph2MeSiOSiMePh2 |
| Benzene, 1,1',1'',1'''-(1,3-dimethyl-1,3-disiloxanediylidene)tetrakis- |
| 1,3-Dimethyl-1,1,3,3-tetraphenyldisiloxane |
| tetraphenyldimethyldisiloxane |
| 1,3-dimethyltetraphenyldisiloxane |
| EINECS 212-361-3 |
| Disiloxane, 1,3-dimethyl-1,1,3,3-tetraphenyl- |
| 1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE |
