Introduction：Basic information about CAS 20083-34-5|Triethoxy(pentafluorophenyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triethoxy(pentafluorophenyl)silane |
|---|
| CAS Number | 20083-34-5 | Molecular Weight | 330.323 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 245.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15F5O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 102.2±27.3 °C |
|---|
Names
| Name | triethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 245.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15F5O3Si |
|---|
| Molecular Weight | 330.323 |
|---|
| Flash Point | 102.2±27.3 °C |
|---|
| Exact Mass | 330.071075 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.17 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.432 |
|---|
| InChIKey | QALDFNLNVLQDSP-UHFFFAOYSA-N |
|---|
| SMILES | CCO[Si](OCC)(OCC)c1c(F)c(F)c(F)c(F)c1F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| pentafluorophenyltriethoxysilane |
| Benzene, 1,2,3,4,5-pentafluoro-6-(triethoxysilyl)- |
| (Pentafluorphenyl)-triethoxysilan |
| (Pentafluorophenyl)tris(ethoxy)silane |
| MFCD03411257 |
| (EtO)3SiC6F5 |
| pentafluorophenylethoxysilane |
| triethoxy-pentafluorophenyl-silane |
| Pentafluorphenyl-triaethoxysilan |
| Triethoxy(pentafluorophenyl)silane |
