Introduction:Basic information about CAS 84-87-7|1-Naphthol-4-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthol-4-sulfonic acid |
|---|
| CAS Number | 84-87-7 | Molecular Weight | 224.233 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 427ºC |
|---|
| Molecular Formula | C10H8O4S | Melting Point | 170℃ |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-Naphthol-4-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 427ºC |
|---|
| Melting Point | 170℃ |
|---|
| Molecular Formula | C10H8O4S |
|---|
| Molecular Weight | 224.233 |
|---|
| Exact Mass | 224.014328 |
|---|
| PSA | 82.98000 |
|---|
| LogP | -0.44 |
|---|
| Index of Refraction | 1.704 |
|---|
| InChIKey | HGWQOFDAUWCQDA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc(O)c2ccccc12 |
|---|
Safety Information
| Hazard Codes | Xi,C |
|---|
| Risk Phrases | R34:Causes burns. |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 201-568-4 |
| 4-Hydroxy-1-naphthalenesulfonic acid |
| 1-hydroxy-naphthalene-4-sulphonic acid |
| 1-naphthol-4-sulphonic acid |
| 1-Naphthalenesulfonic acid, 4-hydroxy- |
| Neville and winther acid |
| 4-sulfonaphthol |
| 1-Naphthol-4-sulfoni |
| 1,4-Oxy Acid |
| 1-Naphthol-4-sulfonic acid |
| Nevile-Winthers acid |
| 1-hydroxy-4-naphthalenesulfonic acid |
| naphthalene 1-hydroxy-4-sulfonic acid |
| Neville acid |
| a-Naphthol-4-sulfonic acid |
| MFCD00065324 |
| 4-Hydroxynaphthalene-1-sulfonic acid |
| Nevile-Winther acid |
| HIGH-PURITY N.W. ACID |
| 1-oxynaphthalene-4-sulphonic acid |